C15H26OS — CID 65149747
1-(2,5-dimethylthiophen-3-yl)nonan-1-ol (PubChem CID 65149747) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)nonan-1-ol.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)nonan-1-ol |
|---|---|
| PubChem CID | 65149747 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)nonan-1-ol |
| SMILES | CCCCCCCCC(O)c1cc(C)sc1C |
| InChI | InChI=1S/C15H26OS/c1-4-5-6-7-8-9-10-15(16)14-11-12(2)17-13(14)3/h11,15-16H,4-10H2,1-3H3 |
| InChIKey | MSRWVHHEWODNAI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|