C18H32OS — CID 65428689
1-(2,5-dimethylthiophen-3-yl)dodecan-1-ol (PubChem CID 65428689) has the molecular formula C18H32OS and a molecular weight of 296.52 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)dodecan-1-ol.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)dodecan-1-ol |
|---|---|
| PubChem CID | 65428689 |
| Molecular Formula | C18H32OS |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)dodecan-1-ol |
| SMILES | CCCCCCCCCCCC(O)c1cc(C)sc1C |
| InChI | InChI=1S/C18H32OS/c1-4-5-6-7-8-9-10-11-12-13-18(19)17-14-15(2)20-16(17)3/h14,18-19H,4-13H2,1-3H3 |
| InChIKey | DKXKWZKGFNJEKM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|