C8H11NOS — CID 24973291
2-(2,5-dimethylthiophen-3-yl)acetamide (PubChem CID 24973291) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is 2-(2,5-dimethylthiophen-3-yl)acetamide.
| Compound Name | 2-(2,5-dimethylthiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 24973291 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2-(2,5-dimethylthiophen-3-yl)acetamide |
| SMILES | Cc1cc(CC(N)=O)c(C)s1 |
| InChI | InChI=1S/C8H11NOS/c1-5-3-7(4-8(9)10)6(2)11-5/h3H,4H2,1-2H3,(H2,9,10) |
| InChIKey | WITOBURKOFPAPC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |