C8H9O2S- — CID 23381923
2-(2,5-dimethylthiophen-3-yl)acetate (PubChem CID 23381923) has the molecular formula C8H9O2S- and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-(2,5-dimethylthiophen-3-yl)acetate.
| Compound Name | 2-(2,5-dimethylthiophen-3-yl)acetate |
|---|---|
| PubChem CID | 23381923 |
| Molecular Formula | C8H9O2S- |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2-(2,5-dimethylthiophen-3-yl)acetate |
| SMILES | Cc1cc(CC(=O)[O-])c(C)s1 |
| InChI | InChI=1S/C8H10O2S/c1-5-3-7(4-8(9)10)6(2)11-5/h3H,4H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | ZOFRUWPIASCICK-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |