C17H18OS2 — CID 58288682
S-[2-(2,5-dimethylthiophen-3-yl)ethyl] (E)-3-phenylprop-2-enethioate (PubChem CID 58288682) has the molecular formula C17H18OS2 and a molecular weight of 302.46 g/mol. Its IUPAC name is S-[2-(2,5-dimethylthiophen-3-yl)ethyl] (E)-3-phenylprop-2-enethioate.
| Compound Name | S-[2-(2,5-dimethylthiophen-3-yl)ethyl] (E)-3-phenylprop-2-enethioate |
|---|---|
| PubChem CID | 58288682 |
| Molecular Formula | C17H18OS2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | S-[2-(2,5-dimethylthiophen-3-yl)ethyl] (E)-3-phenylprop-2-enethioate |
| SMILES | Cc1cc(CCSC(=O)/C=C/c2ccccc2)c(C)s1 |
| InChI | InChI=1S/C17H18OS2/c1-13-12-16(14(2)20-13)10-11-19-17(18)9-8-15-6-4-3-5-7-15/h3-9,12H,10-11H2,1-2H3/b9-8+ |
| InChIKey | NJBIAAFNWQPBDF-CMDGGOBGSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|