C19H20O4S — CID 167054585
(E)-3-[3-[2-[2-(carboxymethyl)-5-methylthiophen-3-yl]ethyl]-4-methylphenyl]prop-2-enoic acid (PubChem CID 167054585) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is (E)-3-[3-[2-[2-(carboxymethyl)-5-methylthiophen-3-yl]ethyl]-4-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-[2-(carboxymethyl)-5-methylthiophen-3-yl]ethyl]-4-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 167054585 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (E)-3-[3-[2-[2-(carboxymethyl)-5-methylthiophen-3-yl]ethyl]-4-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(CCc2cc(/C=C/C(=O)O)ccc2C)c(CC(=O)O)s1 |
| InChI | InChI=1S/C19H20O4S/c1-12-3-4-14(5-8-18(20)21)10-15(12)6-7-16-9-13(2)24-17(16)11-19(22)23/h3-5,8-10H,6-7,11H2,1-2H3,(H,20,21)(H,22,23)/b8-5+ |
| InChIKey | YKPWSQYBXMUBCD-VMPITWQZSA-N |
| XLogP | 3.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|