C10H11NO4S — CID 43137804
(E)-3-(3-methyl-4-sulfamoylphenyl)prop-2-enoic acid (PubChem CID 43137804) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is (E)-3-(3-methyl-4-sulfamoylphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(3-methyl-4-sulfamoylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 43137804 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | (E)-3-(3-methyl-4-sulfamoylphenyl)prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11NO4S/c1-7-6-8(3-5-10(12)13)2-4-9(7)16(11,14)15/h2-6H,1H3,(H,12,13)(H2,11,14,15)/b5-3+ |
| InChIKey | ANEVIMPPJMMDCZ-HWKANZROSA-N |
| XLogP | 0.74 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|