C15H13BrOS — CID 7973231
(E)-3-(4-bromophenyl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 7973231) has the molecular formula C15H13BrOS and a molecular weight of 321.24 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-bromophenyl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7973231 |
| Molecular Formula | C15H13BrOS |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | (E)-3-(4-bromophenyl)-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(Br)cc2)c(C)s1 |
| InChI | InChI=1S/C15H13BrOS/c1-10-9-14(11(2)18-10)15(17)8-5-12-3-6-13(16)7-4-12/h3-9H,1-2H3/b8-5+ |
| InChIKey | LOLLISXFABUVOA-VMPITWQZSA-N |
| XLogP | 5.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|