C15H9BrF2O — CID 66667100
3-(4-bromophenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one (PubChem CID 66667100) has the molecular formula C15H9BrF2O and a molecular weight of 323.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one.
| Compound Name | 3-(4-bromophenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 66667100 |
| Molecular Formula | C15H9BrF2O |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 3-(4-bromophenyl)-1-(2,5-difluorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Br)cc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H9BrF2O/c16-11-4-1-10(2-5-11)3-8-15(19)13-9-12(17)6-7-14(13)18/h1-9H |
| InChIKey | ORRSOPSWVRVUDB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|