C16H9F5O — CID 8832351
(E)-1-(2,5-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 8832351) has the molecular formula C16H9F5O and a molecular weight of 312.24 g/mol. Its IUPAC name is (E)-1-(2,5-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8832351 |
| Molecular Formula | C16H9F5O |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (E)-1-(2,5-difluorophenyl)-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1C(F)(F)F)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H9F5O/c17-11-6-7-14(18)12(9-11)15(22)8-5-10-3-1-2-4-13(10)16(19,20)21/h1-9H/b8-5+ |
| InChIKey | UFTZENXKXVZION-VMPITWQZSA-N |
| XLogP | 4.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|