C10H6F2O3 — CID 10703736
(E)-4-(2,5-difluorophenyl)-4-oxobut-2-enoic acid (PubChem CID 10703736) has the molecular formula C10H6F2O3 and a molecular weight of 212.15 g/mol. Its IUPAC name is (E)-4-(2,5-difluorophenyl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2,5-difluorophenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 10703736 |
| Molecular Formula | C10H6F2O3 |
| Molecular Weight | 212.15 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | (E)-4-(2,5-difluorophenyl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H6F2O3/c11-6-1-2-8(12)7(5-6)9(13)3-4-10(14)15/h1-5H,(H,14,15)/b4-3+ |
| InChIKey | PJBMRMYWNHFFCB-ONEGZZNKSA-N |
| XLogP | 1.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|