C15H10F2O — CID 139410586
(E)-1,3-bis(2-fluorophenyl)prop-2-en-1-one (PubChem CID 139410586) has the molecular formula C15H10F2O and a molecular weight of 244.24 g/mol. Its IUPAC name is (E)-1,3-bis(2-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1,3-bis(2-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139410586 |
| Molecular Formula | C15H10F2O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (E)-1,3-bis(2-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1F)c1ccccc1F |
| InChI | InChI=1S/C15H10F2O/c16-13-7-3-1-5-11(13)9-10-15(18)12-6-2-4-8-14(12)17/h1-10H/b10-9+ |
| InChIKey | FFWSKGOESIYIBD-MDZDMXLPSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|