C16H9F2O3- — CID 8826837
4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate (PubChem CID 8826837) has the molecular formula C16H9F2O3- and a molecular weight of 287.24 g/mol. Its IUPAC name is 4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | 4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 8826837 |
| Molecular Formula | C16H9F2O3- |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-[(E)-3-(2,4-difluorophenyl)-3-oxoprop-1-enyl]benzoate |
| SMILES | O=C([O-])c1ccc(/C=C/C(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H10F2O3/c17-12-6-7-13(14(18)9-12)15(19)8-3-10-1-4-11(5-2-10)16(20)21/h1-9H,(H,20,21)/p-1/b8-3+ |
| InChIKey | DPBKQBSZCOOPBB-FPYGCLRLSA-M |
| XLogP | 2.22 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|