C18H14F2O2 — CID 75849641
1-(2,4-difluorophenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 75849641) has the molecular formula C18H14F2O2 and a molecular weight of 300.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75849641 |
| Molecular Formula | C18H14F2O2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H14F2O2/c1-2-11-22-15-7-3-13(4-8-15)5-10-18(21)16-9-6-14(19)12-17(16)20/h2-10,12H,1,11H2 |
| InChIKey | NZJADDOBUHYFAD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|