C20H15Br3O3S — CID 19556920
(E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19556920) has the molecular formula C20H15Br3O3S and a molecular weight of 575.12 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19556920 |
| Molecular Formula | C20H15Br3O3S |
| Molecular Weight | 575.12 g/mol |
| Exact Mass | 571.83 |
| IUPAC Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-[(2,4,6-tribromophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(COc3c(Br)cc(Br)cc3Br)o2)c(C)s1 |
| InChI | InChI=1S/C20H15Br3O3S/c1-11-7-16(12(2)27-11)19(24)6-5-14-3-4-15(26-14)10-25-20-17(22)8-13(21)9-18(20)23/h3-9H,10H2,1-2H3/b6-5+ |
| InChIKey | LVFOIIDVNCPDSS-AATRIKPKSA-N |
| XLogP | 7.72 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.12 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|