C22H22O3S — CID 19558531
(E)-3-[5-[(3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one (PubChem CID 19558531) has the molecular formula C22H22O3S and a molecular weight of 366.48 g/mol. Its IUPAC name is (E)-3-[5-[(3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19558531 |
| Molecular Formula | C22H22O3S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (E)-3-[5-[(3,5-dimethylphenoxy)methyl]furan-2-yl]-1-(2,5-dimethylthiophen-3-yl)prop-2-en-1-one |
| SMILES | Cc1cc(C)cc(OCc2ccc(/C=C/C(=O)c3cc(C)sc3C)o2)c1 |
| InChI | InChI=1S/C22H22O3S/c1-14-9-15(2)11-20(10-14)24-13-19-6-5-18(25-19)7-8-22(23)21-12-16(3)26-17(21)4/h5-12H,13H2,1-4H3/b8-7+ |
| InChIKey | ITAXDMYZXBQXMC-BQYQJAHWSA-N |
| XLogP | 6.05 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|