C14H14O3 — CID 7019247
5-[(3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde (PubChem CID 7019247) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde.
| Compound Name | 5-[(3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 7019247 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-[(3,5-dimethylphenoxy)methyl]furan-2-carbaldehyde |
| SMILES | Cc1cc(C)cc(OCc2ccc(C=O)o2)c1 |
| InChI | InChI=1S/C14H14O3/c1-10-5-11(2)7-14(6-10)16-9-13-4-3-12(8-15)17-13/h3-8H,9H2,1-2H3 |
| InChIKey | HIIUTXJHRYIGQA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|