C19H15ClO3S — CID 19555148
(E)-3-[5-[(4-chlorophenoxy)methyl]furan-2-yl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19555148) has the molecular formula C19H15ClO3S and a molecular weight of 358.85 g/mol. Its IUPAC name is (E)-3-[5-[(4-chlorophenoxy)methyl]furan-2-yl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-chlorophenoxy)methyl]furan-2-yl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19555148 |
| Molecular Formula | C19H15ClO3S |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | (E)-3-[5-[(4-chlorophenoxy)methyl]furan-2-yl]-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(COc3ccc(Cl)cc3)o2)s1 |
| InChI | InChI=1S/C19H15ClO3S/c1-13-2-11-19(24-13)18(21)10-9-16-7-8-17(23-16)12-22-15-5-3-14(20)4-6-15/h2-11H,12H2,1H3/b10-9+ |
| InChIKey | YFJQGWAHOWXUTL-MDZDMXLPSA-N |
| XLogP | 5.78 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|