C20H18O3S — CID 19558594
(E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one (PubChem CID 19558594) has the molecular formula C20H18O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19558594 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (E)-1-(2,5-dimethylthiophen-3-yl)-3-[5-(phenoxymethyl)furan-2-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/c2ccc(COc3ccccc3)o2)c(C)s1 |
| InChI | InChI=1S/C20H18O3S/c1-14-12-19(15(2)24-14)20(21)11-10-17-8-9-18(23-17)13-22-16-6-4-3-5-7-16/h3-12H,13H2,1-2H3/b11-10+ |
| InChIKey | DEWVXCJEGLOOBD-ZHACJKMWSA-N |
| XLogP | 5.43 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|