C22H20O5 — CID 19540762
(E)-1-(2,4-dihydroxyphenyl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19540762) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19540762 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[5-[(4-ethylphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCc1ccc(OCc2ccc(/C=C/C(=O)c3ccc(O)cc3O)o2)cc1 |
| InChI | InChI=1S/C22H20O5/c1-2-15-3-6-17(7-4-15)26-14-19-9-8-18(27-19)10-12-21(24)20-11-5-16(23)13-22(20)25/h3-13,23,25H,2,14H2,1H3/b12-10+ |
| InChIKey | ZSIZOELYDPWBHP-ZRDIBKRKSA-N |
| XLogP | 4.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|