C20H11Cl5O5 — CID 19540670
(E)-1-(2,4-dihydroxyphenyl)-3-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19540670) has the molecular formula C20H11Cl5O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is (E)-1-(2,4-dihydroxyphenyl)-3-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dihydroxyphenyl)-3-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19540670 |
| Molecular Formula | C20H11Cl5O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 505.90 |
| IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1)c1ccc(O)cc1O |
| InChI | InChI=1S/C20H11Cl5O5/c21-15-16(22)18(24)20(19(25)17(15)23)29-8-11-3-2-10(30-11)4-6-13(27)12-5-1-9(26)7-14(12)28/h1-7,26,28H,8H2/b6-4+ |
| InChIKey | QYFQDAFMSINSBJ-GQCTYLIASA-N |
| XLogP | 7.43 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|