C20H13Cl3O4 — CID 19562772
(E)-1-(3-hydroxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19562772) has the molecular formula C20H13Cl3O4 and a molecular weight of 423.68 g/mol. Its IUPAC name is (E)-1-(3-hydroxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3-hydroxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19562772 |
| Molecular Formula | C20H13Cl3O4 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | (E)-1-(3-hydroxyphenyl)-3-[5-[(2,4,6-trichlorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2c(Cl)cc(Cl)cc2Cl)o1)c1cccc(O)c1 |
| InChI | InChI=1S/C20H13Cl3O4/c21-13-9-17(22)20(18(23)10-13)26-11-16-5-4-15(27-16)6-7-19(25)12-2-1-3-14(24)8-12/h1-10,24H,11H2/b7-6+ |
| InChIKey | VNYPOHNPWXOFLF-VOTSOKGWSA-N |
| XLogP | 6.42 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|