C20H15BrO4 — CID 19562801
(E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one (PubChem CID 19562801) has the molecular formula C20H15BrO4 and a molecular weight of 399.24 g/mol. Its IUPAC name is (E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19562801 |
| Molecular Formula | C20H15BrO4 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (E)-3-[5-[(3-bromophenoxy)methyl]furan-2-yl]-1-(3-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2cccc(Br)c2)o1)c1cccc(O)c1 |
| InChI | InChI=1S/C20H15BrO4/c21-15-4-2-6-18(12-15)24-13-19-8-7-17(25-19)9-10-20(23)14-3-1-5-16(22)11-14/h1-12,22H,13H2/b10-9+ |
| InChIKey | AESQSSHTXASSFU-MDZDMXLPSA-N |
| XLogP | 5.22 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|