C21H17BrO4 — CID 19541318
(E)-1-(4-bromophenyl)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19541318) has the molecular formula C21H17BrO4 and a molecular weight of 413.27 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541318 |
| Molecular Formula | C21H17BrO4 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | COc1ccc(OCc2ccc(/C=C/C(=O)c3ccc(Br)cc3)o2)cc1 |
| InChI | InChI=1S/C21H17BrO4/c1-24-17-6-8-18(9-7-17)25-14-20-11-10-19(26-20)12-13-21(23)15-2-4-16(22)5-3-15/h2-13H,14H2,1H3/b13-12+ |
| InChIKey | VGAPGQHUQLXOGD-OUKQBFOZSA-N |
| XLogP | 5.53 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|