C26H27NO4 — CID 19560841
(E)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one (PubChem CID 19560841) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (E)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19560841 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (E)-3-[5-[(4-methoxyphenoxy)methyl]furan-2-yl]-1-(4-piperidin-1-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OCc2ccc(/C=C/C(=O)c3ccc(N4CCCCC4)cc3)o2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-29-22-9-11-23(12-10-22)30-19-25-14-13-24(31-25)15-16-26(28)20-5-7-21(8-6-20)27-17-3-2-4-18-27/h5-16H,2-4,17-19H2,1H3/b16-15+ |
| InChIKey | KJBHOIDOOKANNS-FOCLMDBBSA-N |
| XLogP | 5.75 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|