C29H28N2O3 — CID 19560761
4-[[2-methoxy-5-[(E)-3-oxo-3-(4-piperidin-1-ylphenyl)prop-1-enyl]phenyl]methoxy]benzonitrile (PubChem CID 19560761) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-[[2-methoxy-5-[(E)-3-oxo-3-(4-piperidin-1-ylphenyl)prop-1-enyl]phenyl]methoxy]benzonitrile.
| Compound Name | 4-[[2-methoxy-5-[(E)-3-oxo-3-(4-piperidin-1-ylphenyl)prop-1-enyl]phenyl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 19560761 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[[2-methoxy-5-[(E)-3-oxo-3-(4-piperidin-1-ylphenyl)prop-1-enyl]phenyl]methoxy]benzonitrile |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(N3CCCCC3)cc2)cc1COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H28N2O3/c1-33-29-16-8-22(19-25(29)21-34-27-13-5-23(20-30)6-14-27)7-15-28(32)24-9-11-26(12-10-24)31-17-3-2-4-18-31/h5-16,19H,2-4,17-18,21H2,1H3/b15-7+ |
| InChIKey | SNKKKQODUCUULA-VIZOYTHASA-N |
| XLogP | 6.03 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|