C26H23BrO3 — CID 19541319
(E)-1-(4-bromophenyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19541319) has the molecular formula C26H23BrO3 and a molecular weight of 463.37 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541319 |
| Molecular Formula | C26H23BrO3 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Br)cc2)cc1COc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C26H23BrO3/c1-29-26-14-6-18(5-13-25(28)20-7-10-23(27)11-8-20)15-22(26)17-30-24-12-9-19-3-2-4-21(19)16-24/h5-16H,2-4,17H2,1H3/b13-5+ |
| InChIKey | IMBVXQUJTWAFPF-WLRTZDKTSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|