C30H34O3 — CID 19571184
(E)-1-(1-adamantyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19571184) has the molecular formula C30H34O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is (E)-1-(1-adamantyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-adamantyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19571184 |
| Molecular Formula | C30H34O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (E)-1-(1-adamantyl)-3-[3-(2,3-dihydro-1H-inden-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C23CC4CC(CC(C4)C2)C3)cc1COc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C30H34O3/c1-32-28-9-5-20(14-26(28)19-33-27-8-7-24-3-2-4-25(24)15-27)6-10-29(31)30-16-21-11-22(17-30)13-23(12-21)18-30/h5-10,14-15,21-23H,2-4,11-13,16-19H2,1H3/b10-6+ |
| InChIKey | BFNDLOAIDWKCSS-UXBLZVDNSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|