C28H30O5 — CID 19571286
(E)-1-(1-adamantyl)-3-[3-(1,3-benzodioxol-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19571286) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (E)-1-(1-adamantyl)-3-[3-(1,3-benzodioxol-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-adamantyl)-3-[3-(1,3-benzodioxol-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19571286 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (E)-1-(1-adamantyl)-3-[3-(1,3-benzodioxol-5-yloxymethyl)-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)C23CC4CC(CC(C4)C2)C3)cc1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H30O5/c1-30-24-5-2-18(11-22(24)16-31-23-4-6-25-26(12-23)33-17-32-25)3-7-27(29)28-13-19-8-20(14-28)10-21(9-19)15-28/h2-7,11-12,19-21H,8-10,13-17H2,1H3/b7-3+ |
| InChIKey | GYGTUPCNOCNUDV-XVNBXDOJSA-N |
| XLogP | 5.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|