C25H21ClO5 — CID 19569019
(E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19569019) has the molecular formula C25H21ClO5 and a molecular weight of 436.89 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569019 |
| Molecular Formula | C25H21ClO5 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc3c(c2)OCO3)cc1COc1ccc(C)cc1Cl |
| InChI | InChI=1S/C25H21ClO5/c1-16-3-8-23(20(26)11-16)29-14-19-12-17(5-9-22(19)28-2)4-7-21(27)18-6-10-24-25(13-18)31-15-30-24/h3-13H,14-15H2,1-2H3/b7-4+ |
| InChIKey | HFBQJAXNOZEADI-QPJJXVBHSA-N |
| XLogP | 5.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|