C28H24ClNO3 — CID 19559114
(E)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one (PubChem CID 19559114) has the molecular formula C28H24ClNO3 and a molecular weight of 457.96 g/mol. Its IUPAC name is (E)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19559114 |
| Molecular Formula | C28H24ClNO3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (E)-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(-n3cccc3)cc2)cc1COc1ccc(C)cc1Cl |
| InChI | InChI=1S/C28H24ClNO3/c1-20-5-13-28(25(29)17-20)33-19-23-18-21(7-14-27(23)32-2)6-12-26(31)22-8-10-24(11-9-22)30-15-3-4-16-30/h3-18H,19H2,1-2H3/b12-6+ |
| InChIKey | MDAZYQKYKSXHKE-WUXMJOGZSA-N |
| XLogP | 6.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|