C29H32O3 — CID 19565067
(E)-3-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 19565067) has the molecular formula C29H32O3 and a molecular weight of 428.57 g/mol. Its IUPAC name is (E)-3-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19565067 |
| Molecular Formula | C29H32O3 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (E)-3-[3-[(2-tert-butyl-5-methylphenoxy)methyl]-4-methoxyphenyl]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(C)cc2)cc1COc1cc(C)ccc1C(C)(C)C |
| InChI | InChI=1S/C29H32O3/c1-20-7-12-23(13-8-20)26(30)15-10-22-11-16-27(31-6)24(18-22)19-32-28-17-21(2)9-14-25(28)29(3,4)5/h7-18H,19H2,1-6H3/b15-10+ |
| InChIKey | PHJDCZNNJTWQBX-XNTDXEJSSA-N |
| XLogP | 7.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|