C23H22O3S — CID 19544700
(E)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 19544700) has the molecular formula C23H22O3S and a molecular weight of 378.49 g/mol. Its IUPAC name is (E)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19544700 |
| Molecular Formula | C23H22O3S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (E)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2cccs2)cc1COc1cc(C)ccc1C |
| InChI | InChI=1S/C23H22O3S/c1-16-6-7-17(2)22(13-16)26-15-19-14-18(9-11-21(19)25-3)8-10-20(24)23-5-4-12-27-23/h4-14H,15H2,1-3H3/b10-8+ |
| InChIKey | XKXUNZGANNBWLT-CSKARUKUSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|