C24H25BrN2O3 — CID 19569326
(E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19569326) has the molecular formula C24H25BrN2O3 and a molecular weight of 469.38 g/mol. Its IUPAC name is (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569326 |
| Molecular Formula | C24H25BrN2O3 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(2,5-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCn1ncc(Br)c1C(=O)/C=C/c1ccc(OC)c(COc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C24H25BrN2O3/c1-5-27-24(20(25)14-26-27)21(28)10-8-18-9-11-22(29-4)19(13-18)15-30-23-12-16(2)6-7-17(23)3/h6-14H,5,15H2,1-4H3/b10-8+ |
| InChIKey | WBZLECMPOLLYDM-CSKARUKUSA-N |
| XLogP | 5.77 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|