C15H14Br2N2O2 — CID 19569382
(E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-en-1-one (PubChem CID 19569382) has the molecular formula C15H14Br2N2O2 and a molecular weight of 414.10 g/mol. Its IUPAC name is (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19569382 |
| Molecular Formula | C15H14Br2N2O2 |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-(5-bromo-2-methoxyphenyl)prop-2-en-1-one |
| SMILES | CCn1ncc(Br)c1C(=O)/C=C/c1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H14Br2N2O2/c1-3-19-15(12(17)9-18-19)13(20)6-4-10-8-11(16)5-7-14(10)21-2/h4-9H,3H2,1-2H3/b6-4+ |
| InChIKey | NXQVJIFJZYTWBR-GQCTYLIASA-N |
| XLogP | 4.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|