C19H18BrClN4O2 — CID 19569391
(E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19569391) has the molecular formula C19H18BrClN4O2 and a molecular weight of 449.74 g/mol. Its IUPAC name is (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19569391 |
| Molecular Formula | C19H18BrClN4O2 |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (E)-1-(4-bromo-1-ethylpyrazol-5-yl)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCn1ncc(Br)c1C(=O)/C=C/c1ccc(OC)c(Cn2cc(Cl)cn2)c1 |
| InChI | InChI=1S/C19H18BrClN4O2/c1-3-25-19(16(20)10-23-25)17(26)6-4-13-5-7-18(27-2)14(8-13)11-24-12-15(21)9-22-24/h4-10,12H,3,11H2,1-2H3/b6-4+ |
| InChIKey | PHNDICSDHSKWJX-GQCTYLIASA-N |
| XLogP | 4.47 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|