C22H21ClN2O4 — CID 19568853
(E)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 19568853) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is (E)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19568853 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (E)-3-[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]-1-(2,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2ccc(OC)c(Cn3cc(Cl)cn3)c2)c1 |
| InChI | InChI=1S/C22H21ClN2O4/c1-27-18-6-9-22(29-3)19(11-18)20(26)7-4-15-5-8-21(28-2)16(10-15)13-25-14-17(23)12-24-25/h4-12,14H,13H2,1-3H3/b7-4+ |
| InChIKey | OJPRIJPIILWSOB-QPJJXVBHSA-N |
| XLogP | 4.51 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|