C14H14BrN3O — CID 114670925
(E)-3-(4-aminophenyl)-1-(4-bromo-1-ethylpyrazol-5-yl)prop-2-en-1-one (PubChem CID 114670925) has the molecular formula C14H14BrN3O and a molecular weight of 320.19 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-1-(4-bromo-1-ethylpyrazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-aminophenyl)-1-(4-bromo-1-ethylpyrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 114670925 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (E)-3-(4-aminophenyl)-1-(4-bromo-1-ethylpyrazol-5-yl)prop-2-en-1-one |
| SMILES | CCn1ncc(Br)c1C(=O)/C=C/c1ccc(N)cc1 |
| InChI | InChI=1S/C14H14BrN3O/c1-2-18-14(12(15)9-17-18)13(19)8-5-10-3-6-11(16)7-4-10/h3-9H,2,16H2,1H3/b8-5+ |
| InChIKey | UYWYJTRMXHCSQK-VMPITWQZSA-N |
| XLogP | 3.14 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|