C23H22O4S — CID 19544755
(E)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one (PubChem CID 19544755) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is (E)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 19544755 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (E)-3-[3-[(2-ethoxyphenoxy)methyl]-4-methoxyphenyl]-1-thiophen-2-ylprop-2-en-1-one |
| SMILES | CCOc1ccccc1OCc1cc(/C=C/C(=O)c2cccs2)ccc1OC |
| InChI | InChI=1S/C23H22O4S/c1-3-26-21-7-4-5-8-22(21)27-16-18-15-17(11-13-20(18)25-2)10-12-19(24)23-9-6-14-28-23/h4-15H,3,16H2,1-2H3/b12-10+ |
| InChIKey | OBHHYZBJUSWXAU-ZRDIBKRKSA-N |
| XLogP | 5.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|