C27H27BrO3S — CID 19544982
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19544982) has the molecular formula C27H27BrO3S and a molecular weight of 511.48 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19544982 |
| Molecular Formula | C27H27BrO3S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | C=CCc1ccccc1OCc1cc(/C=C/C(=O)c2cc(Br)c(CCC)s2)ccc1OC |
| InChI | InChI=1S/C27H27BrO3S/c1-4-8-20-10-6-7-11-25(20)31-18-21-16-19(13-15-24(21)30-3)12-14-23(29)27-17-22(28)26(32-27)9-5-2/h4,6-7,10-17H,1,5,8-9,18H2,2-3H3/b14-12+ |
| InChIKey | XZDIAWSGMIQMHI-WYMLVPIESA-N |
| XLogP | 7.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|