C26H23FO3 — CID 19551244
(E)-1-(4-fluorophenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19551244) has the molecular formula C26H23FO3 and a molecular weight of 402.47 g/mol. Its IUPAC name is (E)-1-(4-fluorophenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-fluorophenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19551244 |
| Molecular Formula | C26H23FO3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (E)-1-(4-fluorophenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | C=CCc1ccccc1OCc1cc(/C=C/C(=O)c2ccc(F)cc2)ccc1OC |
| InChI | InChI=1S/C26H23FO3/c1-3-6-21-7-4-5-8-26(21)30-18-22-17-19(10-16-25(22)29-2)9-15-24(28)20-11-13-23(27)14-12-20/h3-5,7-17H,1,6,18H2,2H3/b15-9+ |
| InChIKey | HSBQXLKBAVWEOL-OQLLNIDSSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|