C29H26N2O3 — CID 19541221
(E)-1-(4-imidazol-1-ylphenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19541221) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is (E)-1-(4-imidazol-1-ylphenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-imidazol-1-ylphenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19541221 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (E)-1-(4-imidazol-1-ylphenyl)-3-[4-methoxy-3-[(2-prop-2-enylphenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | C=CCc1ccccc1OCc1cc(/C=C/C(=O)c2ccc(-n3ccnc3)cc2)ccc1OC |
| InChI | InChI=1S/C29H26N2O3/c1-3-6-24-7-4-5-8-29(24)34-20-25-19-22(10-16-28(25)33-2)9-15-27(32)23-11-13-26(14-12-23)31-18-17-30-21-31/h3-5,7-19,21H,1,6,20H2,2H3/b15-9+ |
| InChIKey | FDABZOUKYYVECR-OQLLNIDSSA-N |
| XLogP | 6.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|