C30H25ClO3 — CID 19553030
(E)-3-[3-[(2-benzylphenoxy)methyl]-4-methoxyphenyl]-1-(4-chlorophenyl)prop-2-en-1-one (PubChem CID 19553030) has the molecular formula C30H25ClO3 and a molecular weight of 468.98 g/mol. Its IUPAC name is (E)-3-[3-[(2-benzylphenoxy)methyl]-4-methoxyphenyl]-1-(4-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[(2-benzylphenoxy)methyl]-4-methoxyphenyl]-1-(4-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19553030 |
| Molecular Formula | C30H25ClO3 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (E)-3-[3-[(2-benzylphenoxy)methyl]-4-methoxyphenyl]-1-(4-chlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cl)cc2)cc1COc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C30H25ClO3/c1-33-29-18-12-23(11-17-28(32)24-13-15-27(31)16-14-24)20-26(29)21-34-30-10-6-5-9-25(30)19-22-7-3-2-4-8-22/h2-18,20H,19,21H2,1H3/b17-11+ |
| InChIKey | SCMRSIRZOAHSHG-GZTJUZNOSA-N |
| XLogP | 7.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|