C23H18Cl2O3 — CID 5110556
3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-phenylprop-2-en-1-one (PubChem CID 5110556) has the molecular formula C23H18Cl2O3 and a molecular weight of 413.30 g/mol. Its IUPAC name is 3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5110556 |
| Molecular Formula | C23H18Cl2O3 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-[3-[(2,4-dichlorophenoxy)methyl]-4-methoxyphenyl]-1-phenylprop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2ccccc2)cc1COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl2O3/c1-27-22-11-8-16(7-10-21(26)17-5-3-2-4-6-17)13-18(22)15-28-23-12-9-19(24)14-20(23)25/h2-14H,15H2,1H3 |
| InChIKey | WRYUJFMYNZGHDI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|