C24H18BrF5O3S — CID 19544817
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one (PubChem CID 19544817) has the molecular formula C24H18BrF5O3S and a molecular weight of 561.37 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19544817 |
| Molecular Formula | C24H18BrF5O3S |
| Molecular Weight | 561.37 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[4-methoxy-3-[(2,3,4,5,6-pentafluorophenoxy)methyl]phenyl]prop-2-en-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/c2ccc(OC)c(COc3c(F)c(F)c(F)c(F)c3F)c2)cc1Br |
| InChI | InChI=1S/C24H18BrF5O3S/c1-3-4-17-14(25)10-18(34-17)15(31)7-5-12-6-8-16(32-2)13(9-12)11-33-24-22(29)20(27)19(26)21(28)23(24)30/h5-10H,3-4,11H2,1-2H3/b7-5+ |
| InChIKey | QCUMMLPQFHKQAG-FNORWQNLSA-N |
| XLogP | 7.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.37 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|