C23H24BrN3O4S — CID 19544967
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19544967) has the molecular formula C23H24BrN3O4S and a molecular weight of 518.43 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19544967 |
| Molecular Formula | C23H24BrN3O4S |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/c2ccc(OC)c(Cn3nc(C)c([N+](=O)[O-])c3C)c2)cc1Br |
| InChI | InChI=1S/C23H24BrN3O4S/c1-5-6-21-18(24)12-22(32-21)19(28)9-7-16-8-10-20(31-4)17(11-16)13-26-15(3)23(27(29)30)14(2)25-26/h7-12H,5-6,13H2,1-4H3/b9-7+ |
| InChIKey | PZCXPQUXLYPPNR-VQHVLOKHSA-N |
| XLogP | 6.14 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|