C21H15BrF4O3S — CID 19544939
(E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19544939) has the molecular formula C21H15BrF4O3S and a molecular weight of 503.31 g/mol. Its IUPAC name is (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19544939 |
| Molecular Formula | C21H15BrF4O3S |
| Molecular Weight | 503.31 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | (E)-1-(4-bromo-5-propylthiophen-2-yl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | CCCc1sc(C(=O)/C=C/c2ccc(COc3c(F)c(F)cc(F)c3F)o2)cc1Br |
| InChI | InChI=1S/C21H15BrF4O3S/c1-2-3-17-13(22)8-18(30-17)16(27)7-6-11-4-5-12(29-11)10-28-21-19(25)14(23)9-15(24)20(21)26/h4-9H,2-3,10H2,1H3/b7-6+ |
| InChIKey | BFUHFSKAWNQSCP-VOTSOKGWSA-N |
| XLogP | 7.09 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.31 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|