C21H14F4O3 — CID 19565059
(E)-1-(4-methylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19565059) has the molecular formula C21H14F4O3 and a molecular weight of 390.33 g/mol. Its IUPAC name is (E)-1-(4-methylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19565059 |
| Molecular Formula | C21H14F4O3 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (E)-1-(4-methylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/c2ccc(COc3c(F)c(F)cc(F)c3F)o2)cc1 |
| InChI | InChI=1S/C21H14F4O3/c1-12-2-4-13(5-3-12)18(26)9-8-14-6-7-15(28-14)11-27-21-19(24)16(22)10-17(23)20(21)25/h2-10H,11H2,1H3/b9-8+ |
| InChIKey | VKGWPWDYOKWJIE-CMDGGOBGSA-N |
| XLogP | 5.62 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|