C24H15F4NO3 — CID 19559095
(E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one (PubChem CID 19559095) has the molecular formula C24H15F4NO3 and a molecular weight of 441.38 g/mol. Its IUPAC name is (E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19559095 |
| Molecular Formula | C24H15F4NO3 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | (E)-1-(4-pyrrol-1-ylphenyl)-3-[5-[(2,3,5,6-tetrafluorophenoxy)methyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2c(F)c(F)cc(F)c2F)o1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C24H15F4NO3/c25-19-13-20(26)23(28)24(22(19)27)31-14-18-8-7-17(32-18)9-10-21(30)15-3-5-16(6-4-15)29-11-1-2-12-29/h1-13H,14H2/b10-9+ |
| InChIKey | IIRCDWYNXAGLCA-MDZDMXLPSA-N |
| XLogP | 6.10 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|