C24H17Cl2NO3 — CID 19559081
(E)-3-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one (PubChem CID 19559081) has the molecular formula C24H17Cl2NO3 and a molecular weight of 438.31 g/mol. Its IUPAC name is (E)-3-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19559081 |
| Molecular Formula | C24H17Cl2NO3 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | (E)-3-[5-[(2,6-dichlorophenoxy)methyl]furan-2-yl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(COc2c(Cl)cccc2Cl)o1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C24H17Cl2NO3/c25-21-4-3-5-22(26)24(21)29-16-20-11-10-19(30-20)12-13-23(28)17-6-8-18(9-7-17)27-14-1-2-15-27/h1-15H,16H2/b13-12+ |
| InChIKey | PGSNUROHVYZOAU-OUKQBFOZSA-N |
| XLogP | 6.85 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|